C14H12N2S2 — CID 7674132
4-ethylsulfanyl-6-phenylthieno[2,3-d]pyrimidine (PubChem CID 7674132) has the molecular formula C14H12N2S2 and a molecular weight of 272.40 g/mol. Its IUPAC name is 4-ethylsulfanyl-6-phenylthieno[2,3-d]pyrimidine.
| Compound Name | 4-ethylsulfanyl-6-phenylthieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 7674132 |
| Molecular Formula | C14H12N2S2 |
| Molecular Weight | 272.40 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 4-ethylsulfanyl-6-phenylthieno[2,3-d]pyrimidine |
| SMILES | CCSc1ncnc2sc(-c3ccccc3)cc12 |
| InChI | InChI=1S/C14H12N2S2/c1-2-17-13-11-8-12(10-6-4-3-5-7-10)18-14(11)16-9-15-13/h3-9H,2H2,1H3 |
| InChIKey | HUYDVEHLNWAKOK-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.40 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |