C29H19N3O3S2 — CID 98407624
(2R)-N-(9,10-dioxoanthracen-2-yl)-2-(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylpropanamide (PubChem CID 98407624) has the molecular formula C29H19N3O3S2 and a molecular weight of 521.62 g/mol. Its IUPAC name is (2R)-N-(9,10-dioxoanthracen-2-yl)-2-(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylpropanamide.
| Compound Name | (2R)-N-(9,10-dioxoanthracen-2-yl)-2-(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 98407624 |
| Molecular Formula | C29H19N3O3S2 |
| Molecular Weight | 521.62 g/mol |
| Exact Mass | 521.09 |
| IUPAC Name | (2R)-N-(9,10-dioxoanthracen-2-yl)-2-(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylpropanamide |
| SMILES | C[C@@H](Sc1ncnc2sc(-c3ccccc3)cc12)C(=O)Nc1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C29H19N3O3S2/c1-16(36-28-23-14-24(17-7-3-2-4-8-17)37-29(23)31-15-30-28)27(35)32-18-11-12-21-22(13-18)26(34)20-10-6-5-9-19(20)25(21)33/h2-16H,1H3,(H,32,35)/t16-/m1/s1 |
| InChIKey | OVCQLTGJHVHIRG-MRXNPFEDSA-N |
| XLogP | 6.25 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.62 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|