C12H7N2S2- — CID 7059157
6-phenylthieno[2,3-d]pyrimidine-4-thiolate (PubChem CID 7059157) has the molecular formula C12H7N2S2- and a molecular weight of 243.34 g/mol. Its IUPAC name is 6-phenylthieno[2,3-d]pyrimidine-4-thiolate.
| Compound Name | 6-phenylthieno[2,3-d]pyrimidine-4-thiolate |
|---|---|
| PubChem CID | 7059157 |
| Molecular Formula | C12H7N2S2- |
| Molecular Weight | 243.34 g/mol |
| Exact Mass | 243.01 |
| IUPAC Name | 6-phenylthieno[2,3-d]pyrimidine-4-thiolate |
| SMILES | [S-]c1ncnc2sc(-c3ccccc3)cc12 |
| InChI | InChI=1S/C12H8N2S2/c15-11-9-6-10(8-4-2-1-3-5-8)16-12(9)14-7-13-11/h1-7H,(H,13,14,15)/p-1 |
| InChIKey | ODRXIJABAVSNSW-UHFFFAOYSA-M |
| XLogP | 3.26 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|