C7H11NO8P2S — CID 10068042
[benzenesulfonamido(phosphono)methyl]phosphonic acid (PubChem CID 10068042) has the molecular formula C7H11NO8P2S and a molecular weight of 331.18 g/mol. Its IUPAC name is [benzenesulfonamido(phosphono)methyl]phosphonic acid.
| Compound Name | [benzenesulfonamido(phosphono)methyl]phosphonic acid |
|---|---|
| PubChem CID | 10068042 |
| Molecular Formula | C7H11NO8P2S |
| Molecular Weight | 331.18 g/mol |
| Exact Mass | 330.97 |
| IUPAC Name | [benzenesulfonamido(phosphono)methyl]phosphonic acid |
| SMILES | O=P(O)(O)C(NS(=O)(=O)c1ccccc1)P(=O)(O)O |
| InChI | InChI=1S/C7H11NO8P2S/c9-17(10,11)7(18(12,13)14)8-19(15,16)6-4-2-1-3-5-6/h1-5,7-8H,(H2,9,10,11)(H2,12,13,14) |
| InChIKey | HVGLTRLVWUDEJR-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 161.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.18 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|