C24H14N2O6-4 — CID 102515679
3-[[5-[(2,3-dioxidobenzoyl)amino]naphthalen-1-yl]carbamoyl]benzene-1,2-diolate (PubChem CID 102515679) has the molecular formula C24H14N2O6-4 and a molecular weight of 426.38 g/mol. Its IUPAC name is 3-[[5-[(2,3-dioxidobenzoyl)amino]naphthalen-1-yl]carbamoyl]benzene-1,2-diolate.
| Compound Name | 3-[[5-[(2,3-dioxidobenzoyl)amino]naphthalen-1-yl]carbamoyl]benzene-1,2-diolate |
|---|---|
| PubChem CID | 102515679 |
| Molecular Formula | C24H14N2O6-4 |
| Molecular Weight | 426.38 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | 3-[[5-[(2,3-dioxidobenzoyl)amino]naphthalen-1-yl]carbamoyl]benzene-1,2-diolate |
| SMILES | O=C(Nc1cccc2c(NC(=O)c3cccc([O-])c3[O-])cccc12)c1cccc([O-])c1[O-] |
| InChI | InChI=1S/C24H18N2O6/c27-19-11-3-7-15(21(19)29)23(31)25-17-9-1-5-13-14(17)6-2-10-18(13)26-24(32)16-8-4-12-20(28)22(16)30/h1-12,27-30H,(H,25,31)(H,26,32)/p-4 |
| InChIKey | ZOVBXODDIPCFJM-UHFFFAOYSA-J |
| XLogP | 1.64 |
| TPSA | 150.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.38 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |