C11H14NO9P3 — CID 161093480
[hydroxy(phosphonooxy)phosphoryl]oxy-N-(5-methylnaphthalen-1-yl)phosphonamidic acid (PubChem CID 161093480) has the molecular formula C11H14NO9P3 and a molecular weight of 397.15 g/mol. Its IUPAC name is [hydroxy(phosphonooxy)phosphoryl]oxy-N-(5-methylnaphthalen-1-yl)phosphonamidic acid.
| Compound Name | [hydroxy(phosphonooxy)phosphoryl]oxy-N-(5-methylnaphthalen-1-yl)phosphonamidic acid |
|---|---|
| PubChem CID | 161093480 |
| Molecular Formula | C11H14NO9P3 |
| Molecular Weight | 397.15 g/mol |
| Exact Mass | 396.99 |
| IUPAC Name | [hydroxy(phosphonooxy)phosphoryl]oxy-N-(5-methylnaphthalen-1-yl)phosphonamidic acid |
| SMILES | Cc1cccc2c(NP(=O)(O)OP(=O)(O)OP(=O)(O)O)cccc12 |
| InChI | InChI=1S/C11H14NO9P3/c1-8-4-2-6-10-9(8)5-3-7-11(10)12-22(13,14)20-24(18,19)21-23(15,16)17/h2-7H,1H3,(H,18,19)(H2,12,13,14)(H2,15,16,17) |
| InChIKey | OWZQNBDMVWXUHS-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 162.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.15 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|