C8H10O9P2 — CID 57310076
2-[hydroxy(phosphonooxy)phosphoryl]oxy-3-methylbenzoic acid (PubChem CID 57310076) has the molecular formula C8H10O9P2 and a molecular weight of 312.11 g/mol. Its IUPAC name is 2-[hydroxy(phosphonooxy)phosphoryl]oxy-3-methylbenzoic acid.
| Compound Name | 2-[hydroxy(phosphonooxy)phosphoryl]oxy-3-methylbenzoic acid |
|---|---|
| PubChem CID | 57310076 |
| Molecular Formula | C8H10O9P2 |
| Molecular Weight | 312.11 g/mol |
| Exact Mass | 311.98 |
| IUPAC Name | 2-[hydroxy(phosphonooxy)phosphoryl]oxy-3-methylbenzoic acid |
| SMILES | Cc1cccc(C(=O)O)c1OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C8H10O9P2/c1-5-3-2-4-6(8(9)10)7(5)16-19(14,15)17-18(11,12)13/h2-4H,1H3,(H,9,10)(H,14,15)(H2,11,12,13) |
| InChIKey | JDEBRKDRCLAVAD-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 150.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.11 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|