C11H18O7P2 — CID 154379254
2-(2,3-dimethylphenyl)propan-2-yl phosphono hydrogen phosphate (PubChem CID 154379254) has the molecular formula C11H18O7P2 and a molecular weight of 324.21 g/mol. Its IUPAC name is 2-(2,3-dimethylphenyl)propan-2-yl phosphono hydrogen phosphate.
| Compound Name | 2-(2,3-dimethylphenyl)propan-2-yl phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 154379254 |
| Molecular Formula | C11H18O7P2 |
| Molecular Weight | 324.21 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 2-(2,3-dimethylphenyl)propan-2-yl phosphono hydrogen phosphate |
| SMILES | Cc1cccc(C(C)(C)OP(=O)(O)OP(=O)(O)O)c1C |
| InChI | InChI=1S/C11H18O7P2/c1-8-6-5-7-10(9(8)2)11(3,4)17-20(15,16)18-19(12,13)14/h5-7H,1-4H3,(H,15,16)(H2,12,13,14) |
| InChIKey | KTEOPBACOGRLPW-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.21 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|