C20H22O4 — CID 54419247
acetyl 2,2-bis(2,3-dimethylphenyl)-2-hydroxyacetate (PubChem CID 54419247) has the molecular formula C20H22O4 and a molecular weight of 326.39 g/mol. Its IUPAC name is acetyl 2,2-bis(2,3-dimethylphenyl)-2-hydroxyacetate.
| Compound Name | acetyl 2,2-bis(2,3-dimethylphenyl)-2-hydroxyacetate |
|---|---|
| PubChem CID | 54419247 |
| Molecular Formula | C20H22O4 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | acetyl 2,2-bis(2,3-dimethylphenyl)-2-hydroxyacetate |
| SMILES | CC(=O)OC(=O)C(O)(c1cccc(C)c1C)c1cccc(C)c1C |
| InChI | InChI=1S/C20H22O4/c1-12-8-6-10-17(14(12)3)20(23,19(22)24-16(5)21)18-11-7-9-13(2)15(18)4/h6-11,23H,1-5H3 |
| InChIKey | VZQDDJVCVVSQBS-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|