C28H46O5 — CID 139671186
dioctyl 2-(2,3-dimethylphenyl)-2-hydroxybutanedioate (PubChem CID 139671186) has the molecular formula C28H46O5 and a molecular weight of 462.67 g/mol. Its IUPAC name is dioctyl 2-(2,3-dimethylphenyl)-2-hydroxybutanedioate.
| Compound Name | dioctyl 2-(2,3-dimethylphenyl)-2-hydroxybutanedioate |
|---|---|
| PubChem CID | 139671186 |
| Molecular Formula | C28H46O5 |
| Molecular Weight | 462.67 g/mol |
| Exact Mass | 462.33 |
| IUPAC Name | dioctyl 2-(2,3-dimethylphenyl)-2-hydroxybutanedioate |
| SMILES | CCCCCCCCOC(=O)CC(O)(C(=O)OCCCCCCCC)c1cccc(C)c1C |
| InChI | InChI=1S/C28H46O5/c1-5-7-9-11-13-15-20-32-26(29)22-28(31,25-19-17-18-23(3)24(25)4)27(30)33-21-16-14-12-10-8-6-2/h17-19,31H,5-16,20-22H2,1-4H3 |
| InChIKey | WPYSZHPNONATLV-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.67 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|