C6H10NO9P3 — CID 174882327
[hydroxy(phosphonooxy)phosphoryl]oxy-(3-methyl-2-pyridinyl)phosphinic acid (PubChem CID 174882327) has the molecular formula C6H10NO9P3 and a molecular weight of 333.07 g/mol. Its IUPAC name is [hydroxy(phosphonooxy)phosphoryl]oxy-(3-methyl-2-pyridinyl)phosphinic acid.
| Compound Name | [hydroxy(phosphonooxy)phosphoryl]oxy-(3-methyl-2-pyridinyl)phosphinic acid |
|---|---|
| PubChem CID | 174882327 |
| Molecular Formula | C6H10NO9P3 |
| Molecular Weight | 333.07 g/mol |
| Exact Mass | 332.96 |
| IUPAC Name | [hydroxy(phosphonooxy)phosphoryl]oxy-(3-methyl-2-pyridinyl)phosphinic acid |
| SMILES | Cc1cccnc1P(=O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C6H10NO9P3/c1-5-3-2-4-7-6(5)17(8,9)15-19(13,14)16-18(10,11)12/h2-4H,1H3,(H,8,9)(H,13,14)(H2,10,11,12) |
| InChIKey | BPBCTOJAIZWRCS-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 163.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.07 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|