C5H10N2O8P2 — CID 87110897
phosphono dihydrogen phosphate;pyrimidin-2-ylmethanol (PubChem CID 87110897) has the molecular formula C5H10N2O8P2 and a molecular weight of 288.09 g/mol. Its IUPAC name is phosphono dihydrogen phosphate;pyrimidin-2-ylmethanol.
| Compound Name | phosphono dihydrogen phosphate;pyrimidin-2-ylmethanol |
|---|---|
| PubChem CID | 87110897 |
| Molecular Formula | C5H10N2O8P2 |
| Molecular Weight | 288.09 g/mol |
| Exact Mass | 287.99 |
| IUPAC Name | phosphono dihydrogen phosphate;pyrimidin-2-ylmethanol |
| SMILES | O=P(O)(O)OP(=O)(O)O.OCc1ncccn1 |
| InChI | InChI=1S/C5H6N2O.H4O7P2/c8-4-5-6-2-1-3-7-5;1-8(2,3)7-9(4,5)6/h1-3,8H,4H2;(H2,1,2,3)(H2,4,5,6) |
| InChIKey | BOZHAPQXZKGKLT-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 170.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.09 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|