H6MgO8P2 — CID 176515646
magnesium pyrophosphate hydrate (PubChem CID 176515646) has the molecular formula H6MgO8P2 and a molecular weight of 220.29 g/mol.
| Compound Name | magnesium pyrophosphate hydrate |
|---|---|
| PubChem CID | 176515646 |
| Molecular Formula | H6MgO8P2 |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 219.94 |
| IUPAC Name | — |
| SMILES | O.O=P(O)(O)OP(=O)(O)O.[Mg] |
| InChI | InChI=1S/Mg.H4O7P2.H2O/c;1-8(2,3)7-9(4,5)6;/h;(H2,1,2,3)(H2,4,5,6);1H2 |
| InChIKey | KFOFDUFOSSOCLS-UHFFFAOYSA-N |
| XLogP | -2.02 |
| TPSA | 155.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|