H7AlO7P2Zn — CID 174869151
alumane;phosphono dihydrogen phosphate;zinc (PubChem CID 174869151) has the molecular formula H7AlO7P2Zn and a molecular weight of 273.37 g/mol. Its IUPAC name is alumane;phosphono dihydrogen phosphate;zinc.
| Compound Name | alumane;phosphono dihydrogen phosphate;zinc |
|---|---|
| PubChem CID | 174869151 |
| Molecular Formula | H7AlO7P2Zn |
| Molecular Weight | 273.37 g/mol |
| Exact Mass | 271.88 |
| IUPAC Name | alumane;phosphono dihydrogen phosphate;zinc |
| SMILES | O=P(O)(O)OP(=O)(O)O.[AlH3].[Zn] |
| InChI | InChI=1S/Al.H4O7P2.Zn.3H/c;1-8(2,3)7-9(4,5)6;;;;/h;(H2,1,2,3)(H2,4,5,6);;;; |
| InChIKey | ZSETUMSNTQLDLR-UHFFFAOYSA-N |
| XLogP | -2.00 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.37 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|