H4Al2O7P2+6 — CID 175801807
dialuminum;phosphono dihydrogen phosphate (PubChem CID 175801807) has the molecular formula H4Al2O7P2+6 and a molecular weight of 231.94 g/mol. Its IUPAC name is dialuminum;phosphono dihydrogen phosphate.
| Compound Name | dialuminum;phosphono dihydrogen phosphate |
|---|---|
| PubChem CID | 175801807 |
| Molecular Formula | H4Al2O7P2+6 |
| Molecular Weight | 231.94 g/mol |
| Exact Mass | 231.90 |
| IUPAC Name | dialuminum;phosphono dihydrogen phosphate |
| SMILES | O=P(O)(O)OP(=O)(O)O.[Al+3].[Al+3] |
| InChI | InChI=1S/2Al.H4O7P2/c;;1-8(2,3)7-9(4,5)6/h;;(H2,1,2,3)(H2,4,5,6)/q2*+3; |
| InChIKey | QFJWYYLYAWXVTP-UHFFFAOYSA-N |
| XLogP | -1.57 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.94 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|