H7CuO11P3 — CID 173436835
copper;phosphono dihydrogen phosphate;phosphoric acid (PubChem CID 173436835) has the molecular formula H7CuO11P3 and a molecular weight of 339.51 g/mol. Its IUPAC name is copper;phosphono dihydrogen phosphate;phosphoric acid.
| Compound Name | copper;phosphono dihydrogen phosphate;phosphoric acid |
|---|---|
| PubChem CID | 173436835 |
| Molecular Formula | H7CuO11P3 |
| Molecular Weight | 339.51 g/mol |
| Exact Mass | 338.85 |
| IUPAC Name | copper;phosphono dihydrogen phosphate;phosphoric acid |
| SMILES | O=P(O)(O)O.O=P(O)(O)OP(=O)(O)O.[Cu] |
| InChI | InChI=1S/Cu.H4O7P2.H3O4P/c;1-8(2,3)7-9(4,5)6;1-5(2,3)4/h;(H2,1,2,3)(H2,4,5,6);(H3,1,2,3,4) |
| InChIKey | SJFITURGWVFEDQ-UHFFFAOYSA-N |
| XLogP | -1.74 |
| TPSA | 202.05 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.51 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|