C6H10NO10P3 — CID 174627970
anilino [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate (PubChem CID 174627970) has the molecular formula C6H10NO10P3 and a molecular weight of 349.07 g/mol. Its IUPAC name is anilino [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate.
| Compound Name | anilino [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate |
|---|---|
| PubChem CID | 174627970 |
| Molecular Formula | C6H10NO10P3 |
| Molecular Weight | 349.07 g/mol |
| Exact Mass | 348.95 |
| IUPAC Name | anilino [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate |
| SMILES | O=P(O)(O)OP(=O)(O)OP(=O)(O)ONc1ccccc1 |
| InChI | InChI=1S/C6H10NO10P3/c8-18(9,10)16-20(13,14)17-19(11,12)15-7-6-4-2-1-3-5-6/h1-5,7H,(H,11,12)(H,13,14)(H2,8,9,10) |
| InChIKey | SFZLUJKCVGPETB-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 171.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.07 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|