C12H18O17P4 — CID 174668054
bis(benzene-1,3-diol);[hydroxy(phosphonooxy)phosphoryl] phosphono hydrogen phosphate (PubChem CID 174668054) has the molecular formula C12H18O17P4 and a molecular weight of 558.16 g/mol. Its IUPAC name is bis(benzene-1,3-diol);[hydroxy(phosphonooxy)phosphoryl] phosphono hydrogen phosphate.
| Compound Name | bis(benzene-1,3-diol);[hydroxy(phosphonooxy)phosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 174668054 |
| Molecular Formula | C12H18O17P4 |
| Molecular Weight | 558.16 g/mol |
| Exact Mass | 557.95 |
| IUPAC Name | bis(benzene-1,3-diol);[hydroxy(phosphonooxy)phosphoryl] phosphono hydrogen phosphate |
| SMILES | O=P(O)(O)OP(=O)(O)OP(=O)(O)OP(=O)(O)O.Oc1cccc(O)c1.Oc1cccc(O)c1 |
| InChI | InChI=1S/2C6H6O2.H6O13P4/c2*7-5-2-1-3-6(8)4-5;1-14(2,3)11-16(7,8)13-17(9,10)12-15(4,5)6/h2*1-4,7-8H;(H,7,8)(H,9,10)(H2,1,2,3)(H2,4,5,6) |
| InChIKey | FNIAKEBSHQGFOC-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 298.27 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.16 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|