About bis(benzene-1,3-diol);hydrate
bis(benzene-1,3-diol);hydrate (PubChem CID 174320343) has the molecular formula C12H14O5
and a molecular weight of 238.24 g/mol. Its IUPAC name is bis(benzene-1,3-diol);hydrate.
Molecular Properties
| Compound Name | bis(benzene-1,3-diol);hydrate |
| PubChem CID | 174320343 |
| Molecular Formula | C12H14O5 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | bis(benzene-1,3-diol);hydrate |
| SMILES | O.Oc1cccc(O)c1.Oc1cccc(O)c1 |
| InChI | InChI=1S/2C6H6O2.H2O/c2*7-5-2-1-3-6(8)4-5;/h2*1-4,7-8H;1H2 |
| InChIKey | HMJNELPHOPFDHO-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 112.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze bis(benzene-1,3-diol);hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(benzene-1,3-diol);hydrate?
The IUPAC name of bis(benzene-1,3-diol);hydrate (CID 174320343) is bis(benzene-1,3-diol);hydrate.
What is the SMILES notation for bis(benzene-1,3-diol);hydrate?
The canonical SMILES for bis(benzene-1,3-diol);hydrate is O.Oc1cccc(O)c1.Oc1cccc(O)c1.
What is the InChIKey of bis(benzene-1,3-diol);hydrate?
The InChIKey is HMJNELPHOPFDHO-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H6O2.H2O/c2*7-5-2-1-3-6(8)4-5;/h2*1-4,7-8H;1H2.
What are the key properties of bis(benzene-1,3-diol);hydrate?
bis(benzene-1,3-diol);hydrate has a molecular weight of 238.24 g/mol, XLogP of 1.37, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(benzene-1,3-diol);hydrate is sourced from PubChem (CID 174320343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).