About bis(benzene-1,3-diol);methane
bis(benzene-1,3-diol);methane (PubChem CID 70633400) has the molecular formula C13H16O4
and a molecular weight of 236.27 g/mol. Its IUPAC name is bis(benzene-1,3-diol);methane.
Molecular Properties
| Compound Name | bis(benzene-1,3-diol);methane |
| PubChem CID | 70633400 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | bis(benzene-1,3-diol);methane |
| SMILES | C.Oc1cccc(O)c1.Oc1cccc(O)c1 |
| InChI | InChI=1S/2C6H6O2.CH4/c2*7-5-2-1-3-6(8)4-5;/h2*1-4,7-8H;1H4 |
| InChIKey | NPFXEPUFGBPZSM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze bis(benzene-1,3-diol);methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(benzene-1,3-diol);methane?
The IUPAC name of bis(benzene-1,3-diol);methane (CID 70633400) is bis(benzene-1,3-diol);methane.
What is the SMILES notation for bis(benzene-1,3-diol);methane?
The canonical SMILES for bis(benzene-1,3-diol);methane is C.Oc1cccc(O)c1.Oc1cccc(O)c1.
What is the InChIKey of bis(benzene-1,3-diol);methane?
The InChIKey is NPFXEPUFGBPZSM-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H6O2.CH4/c2*7-5-2-1-3-6(8)4-5;/h2*1-4,7-8H;1H4.
What are the key properties of bis(benzene-1,3-diol);methane?
bis(benzene-1,3-diol);methane has a molecular weight of 236.27 g/mol, XLogP of 2.83, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(benzene-1,3-diol);methane is sourced from PubChem (CID 70633400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).