About benzene-1,3-diol;bis(rutherfordium)
benzene-1,3-diol;bis(rutherfordium) (PubChem CID 140661178) has the molecular formula C6H6O2Rf2
and a molecular weight of 644.11 g/mol. Its IUPAC name is benzene-1,3-diol;bis(rutherfordium).
Molecular Properties
| Compound Name | benzene-1,3-diol;bis(rutherfordium) |
| PubChem CID | 140661178 |
| Molecular Formula | C6H6O2Rf2 |
| Molecular Weight | 644.11 g/mol |
| Exact Mass | 644.28 |
| IUPAC Name | benzene-1,3-diol;bis(rutherfordium) |
| SMILES | Oc1cccc(O)c1.[Rf].[Rf] |
| InChI | InChI=1S/C6H6O2.2Rf/c7-5-2-1-3-6(8)4-5;;/h1-4,7-8H;; |
| InChIKey | ZSSYMVJTHQNQPS-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 644.11 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzene-1,3-diol;bis(rutherfordium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,3-diol;bis(rutherfordium)?
The IUPAC name of benzene-1,3-diol;bis(rutherfordium) (CID 140661178) is benzene-1,3-diol;bis(rutherfordium).
What is the SMILES notation for benzene-1,3-diol;bis(rutherfordium)?
The canonical SMILES for benzene-1,3-diol;bis(rutherfordium) is Oc1cccc(O)c1.[Rf].[Rf].
What is the InChIKey of benzene-1,3-diol;bis(rutherfordium)?
The InChIKey is ZSSYMVJTHQNQPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O2.2Rf/c7-5-2-1-3-6(8)4-5;;/h1-4,7-8H;;.
What are the key properties of benzene-1,3-diol;bis(rutherfordium)?
benzene-1,3-diol;bis(rutherfordium) has a molecular weight of 644.11 g/mol, XLogP of 1.10, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,3-diol;bis(rutherfordium) is sourced from PubChem (CID 140661178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).