C12H14N2O6P2 — CID 54669881
[[(4-phenyl-2-pyridinyl)amino]-phosphonomethyl]phosphonic acid (PubChem CID 54669881) has the molecular formula C12H14N2O6P2 and a molecular weight of 344.20 g/mol. Its IUPAC name is [[(4-phenyl-2-pyridinyl)amino]-phosphonomethyl]phosphonic acid.
| Compound Name | [[(4-phenyl-2-pyridinyl)amino]-phosphonomethyl]phosphonic acid |
|---|---|
| PubChem CID | 54669881 |
| Molecular Formula | C12H14N2O6P2 |
| Molecular Weight | 344.20 g/mol |
| Exact Mass | 344.03 |
| IUPAC Name | [[(4-phenyl-2-pyridinyl)amino]-phosphonomethyl]phosphonic acid |
| SMILES | O=P(O)(O)C(Nc1cc(-c2ccccc2)ccn1)P(=O)(O)O |
| InChI | InChI=1S/C12H14N2O6P2/c15-21(16,17)12(22(18,19)20)14-11-8-10(6-7-13-11)9-4-2-1-3-5-9/h1-8,12H,(H,13,14)(H2,15,16,17)(H2,18,19,20) |
| InChIKey | ILDQYPKLOXAUMC-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 139.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.20 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|