C13H20N4O6P2 — CID 170377288
[[[4-(3,3a,4,5,6,7-hexahydroindazol-2-yl)-2-pyridinyl]amino]-phosphonomethyl]phosphonic acid (PubChem CID 170377288) has the molecular formula C13H20N4O6P2 and a molecular weight of 390.27 g/mol. Its IUPAC name is [[[4-(3,3a,4,5,6,7-hexahydroindazol-2-yl)-2-pyridinyl]amino]-phosphonomethyl]phosphonic acid.
| Compound Name | [[[4-(3,3a,4,5,6,7-hexahydroindazol-2-yl)-2-pyridinyl]amino]-phosphonomethyl]phosphonic acid |
|---|---|
| PubChem CID | 170377288 |
| Molecular Formula | C13H20N4O6P2 |
| Molecular Weight | 390.27 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | [[[4-(3,3a,4,5,6,7-hexahydroindazol-2-yl)-2-pyridinyl]amino]-phosphonomethyl]phosphonic acid |
| SMILES | O=P(O)(O)C(Nc1cc(N2CC3CCCCC3=N2)ccn1)P(=O)(O)O |
| InChI | InChI=1S/C13H20N4O6P2/c18-24(19,20)13(25(21,22)23)15-12-7-10(5-6-14-12)17-8-9-3-1-2-4-11(9)16-17/h5-7,9,13H,1-4,8H2,(H,14,15)(H2,18,19,20)(H2,21,22,23) |
| InChIKey | QCRXYCDSUSGCBU-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 155.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.27 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|