C16H26N4 — CID 75047936
N-(cyclopentylmethyl)-4-[3-(methylamino)pyrrolidin-1-yl]pyridin-2-amine (PubChem CID 75047936) has the molecular formula C16H26N4 and a molecular weight of 274.41 g/mol. Its IUPAC name is N-(cyclopentylmethyl)-4-[3-(methylamino)pyrrolidin-1-yl]pyridin-2-amine.
| Compound Name | N-(cyclopentylmethyl)-4-[3-(methylamino)pyrrolidin-1-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 75047936 |
| Molecular Formula | C16H26N4 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.22 |
| IUPAC Name | N-(cyclopentylmethyl)-4-[3-(methylamino)pyrrolidin-1-yl]pyridin-2-amine |
| SMILES | CNC1CCN(c2ccnc(NCC3CCCC3)c2)C1 |
| InChI | InChI=1S/C16H26N4/c1-17-14-7-9-20(12-14)15-6-8-18-16(10-15)19-11-13-4-2-3-5-13/h6,8,10,13-14,17H,2-5,7,9,11-12H2,1H3,(H,18,19) |
| InChIKey | ASNFGXUCTAGINL-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |