C18H28N4 — CID 58227290
N-(2-bicyclo[2.2.1]heptanylmethyl)-4-[(3R)-3-(methylamino)pyrrolidin-1-yl]pyridin-2-amine (PubChem CID 58227290) has the molecular formula C18H28N4 and a molecular weight of 300.45 g/mol. Its IUPAC name is N-(2-bicyclo[2.2.1]heptanylmethyl)-4-[(3R)-3-(methylamino)pyrrolidin-1-yl]pyridin-2-amine.
| Compound Name | N-(2-bicyclo[2.2.1]heptanylmethyl)-4-[(3R)-3-(methylamino)pyrrolidin-1-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 58227290 |
| Molecular Formula | C18H28N4 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | N-(2-bicyclo[2.2.1]heptanylmethyl)-4-[(3R)-3-(methylamino)pyrrolidin-1-yl]pyridin-2-amine |
| SMILES | CN[C@@H]1CCN(c2ccnc(NCC3CC4CCC3C4)c2)C1 |
| InChI | InChI=1S/C18H28N4/c1-19-16-5-7-22(12-16)17-4-6-20-18(10-17)21-11-15-9-13-2-3-14(15)8-13/h4,6,10,13-16,19H,2-3,5,7-9,11-12H2,1H3,(H,20,21)/t13?,14?,15?,16-/m1/s1 |
| InChIKey | GKMXZHGBRJEESQ-LGGPCSOHSA-N |
| XLogP | 2.73 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |