C20H32N4 — CID 67087675
4-[(3R)-3-(methylamino)pyrrolidin-1-yl]-N-[(1R,2S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]pyridin-2-amine (PubChem CID 67087675) has the molecular formula C20H32N4 and a molecular weight of 328.50 g/mol. Its IUPAC name is 4-[(3R)-3-(methylamino)pyrrolidin-1-yl]-N-[(1R,2S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]pyridin-2-amine.
| Compound Name | 4-[(3R)-3-(methylamino)pyrrolidin-1-yl]-N-[(1R,2S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]pyridin-2-amine |
|---|---|
| PubChem CID | 67087675 |
| Molecular Formula | C20H32N4 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.26 |
| IUPAC Name | 4-[(3R)-3-(methylamino)pyrrolidin-1-yl]-N-[(1R,2S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]pyridin-2-amine |
| SMILES | CN[C@@H]1CCN(c2ccnc(N[C@H]3C[C@H]4C[C@H]([C@@H]3C)C4(C)C)c2)C1 |
| InChI | InChI=1S/C20H32N4/c1-13-17-9-14(20(17,2)3)10-18(13)23-19-11-16(5-7-22-19)24-8-6-15(12-24)21-4/h5,7,11,13-15,17-18,21H,6,8-10,12H2,1-4H3,(H,22,23)/t13-,14+,15+,17+,18-/m0/s1 |
| InChIKey | FBFNSCZZANKPAN-GRLWTPEZSA-N |
| XLogP | 3.36 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |