C17H22N4 — CID 44547719
N-benzyl-4-[(3S)-3-(methylamino)pyrrolidin-1-yl]pyridin-2-amine (PubChem CID 44547719) has the molecular formula C17H22N4 and a molecular weight of 282.39 g/mol. Its IUPAC name is N-benzyl-4-[(3S)-3-(methylamino)pyrrolidin-1-yl]pyridin-2-amine.
| Compound Name | N-benzyl-4-[(3S)-3-(methylamino)pyrrolidin-1-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 44547719 |
| Molecular Formula | C17H22N4 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | N-benzyl-4-[(3S)-3-(methylamino)pyrrolidin-1-yl]pyridin-2-amine |
| SMILES | CN[C@H]1CCN(c2ccnc(NCc3ccccc3)c2)C1 |
| InChI | InChI=1S/C17H22N4/c1-18-15-8-10-21(13-15)16-7-9-19-17(11-16)20-12-14-5-3-2-4-6-14/h2-7,9,11,15,18H,8,10,12-13H2,1H3,(H,19,20)/t15-/m0/s1 |
| InChIKey | FAQTUDDRRFDJAH-HNNXBMFYSA-N |
| XLogP | 2.49 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |