C15H17AsN4 — CID 87167875
CID 87167875 (PubChem CID 87167875) has the molecular formula C15H17AsN4 and a molecular weight of 328.25 g/mol.
| Compound Name | CID 87167875 |
|---|---|
| PubChem CID | 87167875 |
| Molecular Formula | C15H17AsN4 |
| Molecular Weight | 328.25 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | — |
| SMILES | [As]C1CCN(c2ccnc(NCc3ccccn3)c2)C1 |
| InChI | InChI=1S/C15H17AsN4/c16-12-5-8-20(11-12)14-4-7-18-15(9-14)19-10-13-3-1-2-6-17-13/h1-4,6-7,9,12H,5,8,10-11H2,(H,18,19) |
| InChIKey | ZHSQUAZNWZQXAE-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.25 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|