C12H20N4O — CID 58227177
4-[(3R)-3-aminopyrrolidin-1-yl]-N-(2-methoxyethyl)pyridin-2-amine (PubChem CID 58227177) has the molecular formula C12H20N4O and a molecular weight of 236.32 g/mol. Its IUPAC name is 4-[(3R)-3-aminopyrrolidin-1-yl]-N-(2-methoxyethyl)pyridin-2-amine.
| Compound Name | 4-[(3R)-3-aminopyrrolidin-1-yl]-N-(2-methoxyethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 58227177 |
| Molecular Formula | C12H20N4O |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 4-[(3R)-3-aminopyrrolidin-1-yl]-N-(2-methoxyethyl)pyridin-2-amine |
| SMILES | COCCNc1cc(N2CC[C@@H](N)C2)ccn1 |
| InChI | InChI=1S/C12H20N4O/c1-17-7-5-15-12-8-11(2-4-14-12)16-6-3-10(13)9-16/h2,4,8,10H,3,5-7,9,13H2,1H3,(H,14,15)/t10-/m1/s1 |
| InChIKey | XTRSNNDFWWVAJZ-SNVBAGLBSA-N |
| XLogP | 0.68 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|