C19H31N5 — CID 67087373
4-[(3R)-3-(methylamino)pyrrolidin-1-yl]-N-[(1S,2S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]pyrimidin-2-amine (PubChem CID 67087373) has the molecular formula C19H31N5 and a molecular weight of 329.49 g/mol. Its IUPAC name is 4-[(3R)-3-(methylamino)pyrrolidin-1-yl]-N-[(1S,2S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]pyrimidin-2-amine.
| Compound Name | 4-[(3R)-3-(methylamino)pyrrolidin-1-yl]-N-[(1S,2S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 67087373 |
| Molecular Formula | C19H31N5 |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.26 |
| IUPAC Name | 4-[(3R)-3-(methylamino)pyrrolidin-1-yl]-N-[(1S,2S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]pyrimidin-2-amine |
| SMILES | CN[C@@H]1CCN(c2ccnc(N[C@H]3C[C@H]4C[C@@H]([C@@H]3C)C4(C)C)n2)C1 |
| InChI | InChI=1S/C19H31N5/c1-12-15-9-13(19(15,2)3)10-16(12)22-18-21-7-5-17(23-18)24-8-6-14(11-24)20-4/h5,7,12-16,20H,6,8-11H2,1-4H3,(H,21,22,23)/t12-,13+,14+,15-,16-/m0/s1 |
| InChIKey | ZZOXQQOMBIZPSH-OTJKEOIZSA-N |
| XLogP | 2.76 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |