About cyclopentane;[4-(4-cyclopentylpiperazin-1-yl)-2-pyridinyl]carbamic acid
cyclopentane;[4-(4-cyclopentylpiperazin-1-yl)-2-pyridinyl]carbamic acid (PubChem CID 69252651) has the molecular formula C20H32N4O2
and a molecular weight of 360.50 g/mol. Its IUPAC name is cyclopentane;[4-(4-cyclopentylpiperazin-1-yl)-2-pyridinyl]carbamic acid.
Molecular Properties
| Compound Name | cyclopentane;[4-(4-cyclopentylpiperazin-1-yl)-2-pyridinyl]carbamic acid |
| PubChem CID | 69252651 |
| Molecular Formula | C20H32N4O2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | cyclopentane;[4-(4-cyclopentylpiperazin-1-yl)-2-pyridinyl]carbamic acid |
| SMILES | C1CCCC1.O=C(O)Nc1cc(N2CCN(C3CCCC3)CC2)ccn1 |
| InChI | InChI=1S/C15H22N4O2.C5H10/c20-15(21)17-14-11-13(5-6-16-14)19-9-7-18(8-10-19)12-3-1-2-4-12;1-2-4-5-3-1/h5-6,11-12H,1-4,7-10H2,(H,16,17)(H,20,21);1-5H2 |
| InChIKey | WDUBSPYDFPUCOK-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cyclopentane;[4-(4-cyclopentylpiperazin-1-yl)-2-pyridinyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentane;[4-(4-cyclopentylpiperazin-1-yl)-2-pyridinyl]carbamic acid?
The IUPAC name of cyclopentane;[4-(4-cyclopentylpiperazin-1-yl)-2-pyridinyl]carbamic acid (CID 69252651) is cyclopentane;[4-(4-cyclopentylpiperazin-1-yl)-2-pyridinyl]carbamic acid.
What is the SMILES notation for cyclopentane;[4-(4-cyclopentylpiperazin-1-yl)-2-pyridinyl]carbamic acid?
The canonical SMILES for cyclopentane;[4-(4-cyclopentylpiperazin-1-yl)-2-pyridinyl]carbamic acid is C1CCCC1.O=C(O)Nc1cc(N2CCN(C3CCCC3)CC2)ccn1.
What is the InChIKey of cyclopentane;[4-(4-cyclopentylpiperazin-1-yl)-2-pyridinyl]carbamic acid?
The InChIKey is WDUBSPYDFPUCOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N4O2.C5H10/c20-15(21)17-14-11-13(5-6-16-14)19-9-7-18(8-10-19)12-3-1-2-4-12;1-2-4-5-3-1/h5-6,11-12H,1-4,7-10H2,(H,16,17)(H,20,21);1-5H2.
What are the key properties of cyclopentane;[4-(4-cyclopentylpiperazin-1-yl)-2-pyridinyl]carbamic acid?
cyclopentane;[4-(4-cyclopentylpiperazin-1-yl)-2-pyridinyl]carbamic acid has a molecular weight of 360.50 g/mol, XLogP of 4.19, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentane;[4-(4-cyclopentylpiperazin-1-yl)-2-pyridinyl]carbamic acid is sourced from PubChem (CID 69252651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).