C16H24N4O — CID 124749236
4-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-N-propan-2-ylpyridine-2-carboxamide (PubChem CID 124749236) has the molecular formula C16H24N4O and a molecular weight of 288.39 g/mol. Its IUPAC name is 4-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-N-propan-2-ylpyridine-2-carboxamide.
| Compound Name | 4-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-N-propan-2-ylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 124749236 |
| Molecular Formula | C16H24N4O |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | 4-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-N-propan-2-ylpyridine-2-carboxamide |
| SMILES | CC(C)NC(=O)c1cc(N2CCN3CCC[C@H]3C2)ccn1 |
| InChI | InChI=1S/C16H24N4O/c1-12(2)18-16(21)15-10-13(5-6-17-15)20-9-8-19-7-3-4-14(19)11-20/h5-6,10,12,14H,3-4,7-9,11H2,1-2H3,(H,18,21)/t14-/m0/s1 |
| InChIKey | ABWCISJBAWJTSB-AWEZNQCLSA-N |
| XLogP | 1.50 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |