C16H26N4 — CID 79945267
N-[[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-pyridinyl]methyl]propan-1-amine (PubChem CID 79945267) has the molecular formula C16H26N4 and a molecular weight of 274.41 g/mol. Its IUPAC name is N-[[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-pyridinyl]methyl]propan-1-amine.
| Compound Name | N-[[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-pyridinyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 79945267 |
| Molecular Formula | C16H26N4 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.22 |
| IUPAC Name | N-[[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-pyridinyl]methyl]propan-1-amine |
| SMILES | CCCNCc1cc(N2CCN3CCCC3C2)ccn1 |
| InChI | InChI=1S/C16H26N4/c1-2-6-17-12-14-11-15(5-7-18-14)20-10-9-19-8-3-4-16(19)13-20/h5,7,11,16-17H,2-4,6,8-10,12-13H2,1H3 |
| InChIKey | JCWXUBVNNRLFRX-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|