C16H28N4 — CID 114539949
N-[[4-(3,4,5-trimethylpiperazin-1-yl)-2-pyridinyl]methyl]propan-1-amine (PubChem CID 114539949) has the molecular formula C16H28N4 and a molecular weight of 276.43 g/mol. Its IUPAC name is N-[[4-(3,4,5-trimethylpiperazin-1-yl)-2-pyridinyl]methyl]propan-1-amine.
| Compound Name | N-[[4-(3,4,5-trimethylpiperazin-1-yl)-2-pyridinyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 114539949 |
| Molecular Formula | C16H28N4 |
| Molecular Weight | 276.43 g/mol |
| Exact Mass | 276.23 |
| IUPAC Name | N-[[4-(3,4,5-trimethylpiperazin-1-yl)-2-pyridinyl]methyl]propan-1-amine |
| SMILES | CCCNCc1cc(N2CC(C)N(C)C(C)C2)ccn1 |
| InChI | InChI=1S/C16H28N4/c1-5-7-17-10-15-9-16(6-8-18-15)20-11-13(2)19(4)14(3)12-20/h6,8-9,13-14,17H,5,7,10-12H2,1-4H3 |
| InChIKey | PAULWYLBGVQPMV-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.43 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|