C17H30N4 — CID 106907228
N-[[6-[(3,4,5-trimethylpiperazin-1-yl)methyl]-2-pyridinyl]methyl]propan-1-amine (PubChem CID 106907228) has the molecular formula C17H30N4 and a molecular weight of 290.46 g/mol. Its IUPAC name is N-[[6-[(3,4,5-trimethylpiperazin-1-yl)methyl]-2-pyridinyl]methyl]propan-1-amine.
| Compound Name | N-[[6-[(3,4,5-trimethylpiperazin-1-yl)methyl]-2-pyridinyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 106907228 |
| Molecular Formula | C17H30N4 |
| Molecular Weight | 290.46 g/mol |
| Exact Mass | 290.25 |
| IUPAC Name | N-[[6-[(3,4,5-trimethylpiperazin-1-yl)methyl]-2-pyridinyl]methyl]propan-1-amine |
| SMILES | CCCNCc1cccc(CN2CC(C)N(C)C(C)C2)n1 |
| InChI | InChI=1S/C17H30N4/c1-5-9-18-10-16-7-6-8-17(19-16)13-21-11-14(2)20(4)15(3)12-21/h6-8,14-15,18H,5,9-13H2,1-4H3 |
| InChIKey | WEOMNWADAZGIMO-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.46 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|