C16H25FN4 — CID 105390138
N-[[2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-3-fluoro-4-pyridinyl]methyl]propan-1-amine (PubChem CID 105390138) has the molecular formula C16H25FN4 and a molecular weight of 292.40 g/mol. Its IUPAC name is N-[[2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-3-fluoro-4-pyridinyl]methyl]propan-1-amine.
| Compound Name | N-[[2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-3-fluoro-4-pyridinyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 105390138 |
| Molecular Formula | C16H25FN4 |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.21 |
| IUPAC Name | N-[[2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-3-fluoro-4-pyridinyl]methyl]propan-1-amine |
| SMILES | CCCNCc1ccnc(N2CCN3CCCC3C2)c1F |
| InChI | InChI=1S/C16H25FN4/c1-2-6-18-11-13-5-7-19-16(15(13)17)21-10-9-20-8-3-4-14(20)12-21/h5,7,14,18H,2-4,6,8-12H2,1H3 |
| InChIKey | TWXOYXHBHDSXRW-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|