C14H19F4N3 — CID 105390053
N-[[3-fluoro-2-[3-(trifluoromethyl)piperidin-1-yl]-4-pyridinyl]methyl]ethanamine (PubChem CID 105390053) has the molecular formula C14H19F4N3 and a molecular weight of 305.32 g/mol. Its IUPAC name is N-[[3-fluoro-2-[3-(trifluoromethyl)piperidin-1-yl]-4-pyridinyl]methyl]ethanamine.
| Compound Name | N-[[3-fluoro-2-[3-(trifluoromethyl)piperidin-1-yl]-4-pyridinyl]methyl]ethanamine |
|---|---|
| PubChem CID | 105390053 |
| Molecular Formula | C14H19F4N3 |
| Molecular Weight | 305.32 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | N-[[3-fluoro-2-[3-(trifluoromethyl)piperidin-1-yl]-4-pyridinyl]methyl]ethanamine |
| SMILES | CCNCc1ccnc(N2CCCC(C(F)(F)F)C2)c1F |
| InChI | InChI=1S/C14H19F4N3/c1-2-19-8-10-5-6-20-13(12(10)15)21-7-3-4-11(9-21)14(16,17)18/h5-6,11,19H,2-4,7-9H2,1H3 |
| InChIKey | CZBVGUYZJHITLN-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.32 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |