C15H25FN4 — CID 105389828
1-[3-fluoro-4-(propylaminomethyl)-2-pyridinyl]-N,N-dimethylpyrrolidin-3-amine (PubChem CID 105389828) has the molecular formula C15H25FN4 and a molecular weight of 280.39 g/mol. Its IUPAC name is 1-[3-fluoro-4-(propylaminomethyl)-2-pyridinyl]-N,N-dimethylpyrrolidin-3-amine.
| Compound Name | 1-[3-fluoro-4-(propylaminomethyl)-2-pyridinyl]-N,N-dimethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 105389828 |
| Molecular Formula | C15H25FN4 |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.21 |
| IUPAC Name | 1-[3-fluoro-4-(propylaminomethyl)-2-pyridinyl]-N,N-dimethylpyrrolidin-3-amine |
| SMILES | CCCNCc1ccnc(N2CCC(N(C)C)C2)c1F |
| InChI | InChI=1S/C15H25FN4/c1-4-7-17-10-12-5-8-18-15(14(12)16)20-9-6-13(11-20)19(2)3/h5,8,13,17H,4,6-7,9-11H2,1-3H3 |
| InChIKey | HSBXFKOEUCDVBN-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|