C16H26FN3 — CID 105388688
N-[[2-(2,3-dimethylpiperidin-1-yl)-3-fluoro-4-pyridinyl]methyl]propan-1-amine (PubChem CID 105388688) has the molecular formula C16H26FN3 and a molecular weight of 279.40 g/mol. Its IUPAC name is N-[[2-(2,3-dimethylpiperidin-1-yl)-3-fluoro-4-pyridinyl]methyl]propan-1-amine.
| Compound Name | N-[[2-(2,3-dimethylpiperidin-1-yl)-3-fluoro-4-pyridinyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 105388688 |
| Molecular Formula | C16H26FN3 |
| Molecular Weight | 279.40 g/mol |
| Exact Mass | 279.21 |
| IUPAC Name | N-[[2-(2,3-dimethylpiperidin-1-yl)-3-fluoro-4-pyridinyl]methyl]propan-1-amine |
| SMILES | CCCNCc1ccnc(N2CCCC(C)C2C)c1F |
| InChI | InChI=1S/C16H26FN3/c1-4-8-18-11-14-7-9-19-16(15(14)17)20-10-5-6-12(2)13(20)3/h7,9,12-13,18H,4-6,8,10-11H2,1-3H3 |
| InChIKey | YIVBWXKKHSEQTH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|