C16H24FN3O — CID 105389418
N-[[2-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-3-fluoro-4-pyridinyl]methyl]propan-1-amine (PubChem CID 105389418) has the molecular formula C16H24FN3O and a molecular weight of 293.39 g/mol. Its IUPAC name is N-[[2-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-3-fluoro-4-pyridinyl]methyl]propan-1-amine.
| Compound Name | N-[[2-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-3-fluoro-4-pyridinyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 105389418 |
| Molecular Formula | C16H24FN3O |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | N-[[2-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-3-fluoro-4-pyridinyl]methyl]propan-1-amine |
| SMILES | CCCNCc1ccnc(N2CCOC3CCCC32)c1F |
| InChI | InChI=1S/C16H24FN3O/c1-2-7-18-11-12-6-8-19-16(15(12)17)20-9-10-21-14-5-3-4-13(14)20/h6,8,13-14,18H,2-5,7,9-11H2,1H3 |
| InChIKey | TXIVPUMFBUEJLQ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|