C20H25N3O — CID 109210674
4-(3-methylpiperidin-1-yl)-N-(1-phenylethyl)pyridine-2-carboxamide (PubChem CID 109210674) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is 4-(3-methylpiperidin-1-yl)-N-(1-phenylethyl)pyridine-2-carboxamide.
| Compound Name | 4-(3-methylpiperidin-1-yl)-N-(1-phenylethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109210674 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 4-(3-methylpiperidin-1-yl)-N-(1-phenylethyl)pyridine-2-carboxamide |
| SMILES | CC1CCCN(c2ccnc(C(=O)NC(C)c3ccccc3)c2)C1 |
| InChI | InChI=1S/C20H25N3O/c1-15-7-6-12-23(14-15)18-10-11-21-19(13-18)20(24)22-16(2)17-8-4-3-5-9-17/h3-5,8-11,13,15-16H,6-7,12,14H2,1-2H3,(H,22,24) |
| InChIKey | SVWRUGVGSANKHS-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |