C21H27N3O — CID 109210668
4-(cycloheptylamino)-N-(1-phenylethyl)pyridine-2-carboxamide (PubChem CID 109210668) has the molecular formula C21H27N3O and a molecular weight of 337.47 g/mol. Its IUPAC name is 4-(cycloheptylamino)-N-(1-phenylethyl)pyridine-2-carboxamide.
| Compound Name | 4-(cycloheptylamino)-N-(1-phenylethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109210668 |
| Molecular Formula | C21H27N3O |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | 4-(cycloheptylamino)-N-(1-phenylethyl)pyridine-2-carboxamide |
| SMILES | CC(NC(=O)c1cc(NC2CCCCCC2)ccn1)c1ccccc1 |
| InChI | InChI=1S/C21H27N3O/c1-16(17-9-5-4-6-10-17)23-21(25)20-15-19(13-14-22-20)24-18-11-7-2-3-8-12-18/h4-6,9-10,13-16,18H,2-3,7-8,11-12H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | KIEGHJPISGTRPN-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |