About (3-phenylphenyl)carbamic acid
(3-phenylphenyl)carbamic acid (PubChem CID 611602) has the molecular formula C13H11NO2
and a molecular weight of 213.24 g/mol. Its IUPAC name is (3-phenylphenyl)carbamic acid.
Molecular Properties
| Compound Name | (3-phenylphenyl)carbamic acid |
| PubChem CID | 611602 |
| Molecular Formula | C13H11NO2 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | (3-phenylphenyl)carbamic acid |
| SMILES | O=C(O)Nc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C13H11NO2/c15-13(16)14-12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-9,14H,(H,15,16) |
| InChIKey | DRECIEYEWWKVNA-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3-phenylphenyl)carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-phenylphenyl)carbamic acid?
The IUPAC name of (3-phenylphenyl)carbamic acid (CID 611602) is (3-phenylphenyl)carbamic acid.
What is the SMILES notation for (3-phenylphenyl)carbamic acid?
The canonical SMILES for (3-phenylphenyl)carbamic acid is O=C(O)Nc1cccc(-c2ccccc2)c1.
What is the InChIKey of (3-phenylphenyl)carbamic acid?
The InChIKey is DRECIEYEWWKVNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO2/c15-13(16)14-12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-9,14H,(H,15,16).
What are the key properties of (3-phenylphenyl)carbamic acid?
(3-phenylphenyl)carbamic acid has a molecular weight of 213.24 g/mol, XLogP of 3.44, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3-phenylphenyl)carbamic acid is sourced from PubChem (CID 611602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).