(3-phenylphenyl)carbamic acid

C13H11NO2 — CID 611602

IUPAC(3-phenylphenyl)carbamic acid
SMILESO=C(O)Nc1cccc(-c2ccccc2)c1
InChIInChI=1S/C13H11NO2/c15-13(16)14-12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-9,14H,(H,15,16)
InChIKeyDRECIEYEWWKVNA-UHFFFAOYSA-N
MW213.24 g/mol
LogP3.44
Rot. Bonds2

About (3-phenylphenyl)carbamic acid

(3-phenylphenyl)carbamic acid (PubChem CID 611602) has the molecular formula C13H11NO2 and a molecular weight of 213.24 g/mol. Its IUPAC name is (3-phenylphenyl)carbamic acid.

Molecular Properties

Compound Name(3-phenylphenyl)carbamic acid
PubChem CID611602
Molecular FormulaC13H11NO2
Molecular Weight213.24 g/mol
Exact Mass213.08
IUPAC Name(3-phenylphenyl)carbamic acid
SMILESO=C(O)Nc1cccc(-c2ccccc2)c1
InChIInChI=1S/C13H11NO2/c15-13(16)14-12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-9,14H,(H,15,16)
InChIKeyDRECIEYEWWKVNA-UHFFFAOYSA-N
XLogP3.44
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500213.24
LogP ≤ 53.44
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 101

Analyze (3-phenylphenyl)carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3-phenylphenyl)carbamic acid?
The IUPAC name of (3-phenylphenyl)carbamic acid (CID 611602) is (3-phenylphenyl)carbamic acid.
What is the SMILES notation for (3-phenylphenyl)carbamic acid?
The canonical SMILES for (3-phenylphenyl)carbamic acid is O=C(O)Nc1cccc(-c2ccccc2)c1.
What is the InChIKey of (3-phenylphenyl)carbamic acid?
The InChIKey is DRECIEYEWWKVNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO2/c15-13(16)14-12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-9,14H,(H,15,16).
What are the key properties of (3-phenylphenyl)carbamic acid?
(3-phenylphenyl)carbamic acid has a molecular weight of 213.24 g/mol, XLogP of 3.44, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3-phenylphenyl)carbamic acid is sourced from PubChem (CID 611602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).