C14H22BrClN2O3 — CID 133061504
N-[2-(3-bromophenyl)ethyl]-2-(2,2-dimethoxyethylamino)acetamide;hydrochloride (PubChem CID 133061504) has the molecular formula C14H22BrClN2O3 and a molecular weight of 381.70 g/mol. Its IUPAC name is N-[2-(3-bromophenyl)ethyl]-2-(2,2-dimethoxyethylamino)acetamide;hydrochloride.
| Compound Name | N-[2-(3-bromophenyl)ethyl]-2-(2,2-dimethoxyethylamino)acetamide;hydrochloride |
|---|---|
| PubChem CID | 133061504 |
| Molecular Formula | C14H22BrClN2O3 |
| Molecular Weight | 381.70 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | N-[2-(3-bromophenyl)ethyl]-2-(2,2-dimethoxyethylamino)acetamide;hydrochloride |
| SMILES | COC(CNCC(=O)NCCc1cccc(Br)c1)OC.Cl |
| InChI | InChI=1S/C14H21BrN2O3.ClH/c1-19-14(20-2)10-16-9-13(18)17-7-6-11-4-3-5-12(15)8-11;/h3-5,8,14,16H,6-7,9-10H2,1-2H3,(H,17,18);1H |
| InChIKey | LOTWMESLEONJPO-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.70 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|