C14H23ClN2O3 — CID 46224006
2-(2,2-dimethoxyethylamino)-N-(2-phenylethyl)acetamide;hydrochloride (PubChem CID 46224006) has the molecular formula C14H23ClN2O3 and a molecular weight of 302.80 g/mol. Its IUPAC name is 2-(2,2-dimethoxyethylamino)-N-(2-phenylethyl)acetamide;hydrochloride.
| Compound Name | 2-(2,2-dimethoxyethylamino)-N-(2-phenylethyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 46224006 |
| Molecular Formula | C14H23ClN2O3 |
| Molecular Weight | 302.80 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 2-(2,2-dimethoxyethylamino)-N-(2-phenylethyl)acetamide;hydrochloride |
| SMILES | COC(CNCC(=O)NCCc1ccccc1)OC.Cl |
| InChI | InChI=1S/C14H22N2O3.ClH/c1-18-14(19-2)11-15-10-13(17)16-9-8-12-6-4-3-5-7-12;/h3-7,14-15H,8-11H2,1-2H3,(H,16,17);1H |
| InChIKey | NVPWYOJPRJWWJB-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.80 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|