C12H16Br2 — CID 63530904
1-bromo-3-(2-bromo-3,3-dimethylbutyl)benzene (PubChem CID 63530904) has the molecular formula C12H16Br2 and a molecular weight of 320.07 g/mol. Its IUPAC name is 1-bromo-3-(2-bromo-3,3-dimethylbutyl)benzene.
| Compound Name | 1-bromo-3-(2-bromo-3,3-dimethylbutyl)benzene |
|---|---|
| PubChem CID | 63530904 |
| Molecular Formula | C12H16Br2 |
| Molecular Weight | 320.07 g/mol |
| Exact Mass | 317.96 |
| IUPAC Name | 1-bromo-3-(2-bromo-3,3-dimethylbutyl)benzene |
| SMILES | CC(C)(C)C(Br)Cc1cccc(Br)c1 |
| InChI | InChI=1S/C12H16Br2/c1-12(2,3)11(14)8-9-5-4-6-10(13)7-9/h4-7,11H,8H2,1-3H3 |
| InChIKey | USOLCNDSIAWJES-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.07 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|