C12H16BrF — CID 63543994
1-(2-bromo-3,3-dimethylbutyl)-3-fluorobenzene (PubChem CID 63543994) has the molecular formula C12H16BrF and a molecular weight of 259.16 g/mol. Its IUPAC name is 1-(2-bromo-3,3-dimethylbutyl)-3-fluorobenzene.
| Compound Name | 1-(2-bromo-3,3-dimethylbutyl)-3-fluorobenzene |
|---|---|
| PubChem CID | 63543994 |
| Molecular Formula | C12H16BrF |
| Molecular Weight | 259.16 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | 1-(2-bromo-3,3-dimethylbutyl)-3-fluorobenzene |
| SMILES | CC(C)(C)C(Br)Cc1cccc(F)c1 |
| InChI | InChI=1S/C12H16BrF/c1-12(2,3)11(13)8-9-5-4-6-10(14)7-9/h4-7,11H,8H2,1-3H3 |
| InChIKey | DZSNQHFAKUXGET-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.16 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|