C8H7Br2F — CID 89414969
1-(2,2-dibromoethyl)-3-fluorobenzene (PubChem CID 89414969) has the molecular formula C8H7Br2F and a molecular weight of 281.95 g/mol. Its IUPAC name is 1-(2,2-dibromoethyl)-3-fluorobenzene.
| Compound Name | 1-(2,2-dibromoethyl)-3-fluorobenzene |
|---|---|
| PubChem CID | 89414969 |
| Molecular Formula | C8H7Br2F |
| Molecular Weight | 281.95 g/mol |
| Exact Mass | 279.89 |
| IUPAC Name | 1-(2,2-dibromoethyl)-3-fluorobenzene |
| SMILES | Fc1cccc(CC(Br)Br)c1 |
| InChI | InChI=1S/C8H7Br2F/c9-8(10)5-6-2-1-3-7(11)4-6/h1-4,8H,5H2 |
| InChIKey | VZLOOZJMENTPFO-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.95 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|