C15H23BrO — CID 66060363
2-[(3-bromophenyl)methyl]-5,5-dimethylhexan-1-ol (PubChem CID 66060363) has the molecular formula C15H23BrO and a molecular weight of 299.25 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methyl]-5,5-dimethylhexan-1-ol.
| Compound Name | 2-[(3-bromophenyl)methyl]-5,5-dimethylhexan-1-ol |
|---|---|
| PubChem CID | 66060363 |
| Molecular Formula | C15H23BrO |
| Molecular Weight | 299.25 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 2-[(3-bromophenyl)methyl]-5,5-dimethylhexan-1-ol |
| SMILES | CC(C)(C)CCC(CO)Cc1cccc(Br)c1 |
| InChI | InChI=1S/C15H23BrO/c1-15(2,3)8-7-13(11-17)9-12-5-4-6-14(16)10-12/h4-6,10,13,17H,7-9,11H2,1-3H3 |
| InChIKey | OTYGCCSHKRHPRU-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.25 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |