C19H23BrO — CID 66058873
2-[(3-bromophenyl)methyl]-3-(2,4,6-trimethylphenyl)propan-1-ol (PubChem CID 66058873) has the molecular formula C19H23BrO and a molecular weight of 347.30 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methyl]-3-(2,4,6-trimethylphenyl)propan-1-ol.
| Compound Name | 2-[(3-bromophenyl)methyl]-3-(2,4,6-trimethylphenyl)propan-1-ol |
|---|---|
| PubChem CID | 66058873 |
| Molecular Formula | C19H23BrO |
| Molecular Weight | 347.30 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 2-[(3-bromophenyl)methyl]-3-(2,4,6-trimethylphenyl)propan-1-ol |
| SMILES | Cc1cc(C)c(CC(CO)Cc2cccc(Br)c2)c(C)c1 |
| InChI | InChI=1S/C19H23BrO/c1-13-7-14(2)19(15(3)8-13)11-17(12-21)9-16-5-4-6-18(20)10-16/h4-8,10,17,21H,9,11-12H2,1-3H3 |
| InChIKey | HKWTWNJGPSHJRR-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.30 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |